About [6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite
[6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite (PubChem CID 163251171) has the molecular formula C13H10ClFN4OS
and a molecular weight of 324.77 g/mol. Its IUPAC name is [6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite.
Molecular Properties
| Compound Name | [6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite |
| PubChem CID | 163251171 |
| Molecular Formula | C13H10ClFN4OS |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | [6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite |
| SMILES | COc1nccc(C)c1-c1nn(SF)c2nc(Cl)ccc12 |
| InChI | InChI=1S/C13H10ClFN4OS/c1-7-5-6-16-13(20-2)10(7)11-8-3-4-9(14)17-12(8)19(18-11)21-15/h3-6H,1-2H3 |
| InChIKey | XTRCLUGGAFCAJZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite?
The IUPAC name of [6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite (CID 163251171) is [6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite.
What is the SMILES notation for [6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite?
The canonical SMILES for [6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite is COc1nccc(C)c1-c1nn(SF)c2nc(Cl)ccc12.
What is the InChIKey of [6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite?
The InChIKey is XTRCLUGGAFCAJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClFN4OS/c1-7-5-6-16-13(20-2)10(7)11-8-3-4-9(14)17-12(8)19(18-11)21-15/h3-6H,1-2H3.
What are the key properties of [6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite?
[6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite has a molecular weight of 324.77 g/mol, XLogP of 3.84, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-chloro-3-(2-methoxy-4-methyl-3-pyridinyl)pyrazolo[5,4-b]pyridin-1-yl] thiohypofluorite is sourced from PubChem (CID 163251171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).