C10H5ClFN3S — CID 145132591
(11-chloro-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl) thiohypofluorite (PubChem CID 145132591) has the molecular formula C10H5ClFN3S and a molecular weight of 253.69 g/mol. Its IUPAC name is (11-chloro-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl) thiohypofluorite.
| Compound Name | (11-chloro-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl) thiohypofluorite |
|---|---|
| PubChem CID | 145132591 |
| Molecular Formula | C10H5ClFN3S |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | (11-chloro-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl) thiohypofluorite |
| SMILES | FSn1c2ccncc2c2ccc(Cl)nc21 |
| InChI | InChI=1S/C10H5ClFN3S/c11-9-2-1-6-7-5-13-4-3-8(7)15(16-12)10(6)14-9/h1-5H |
| InChIKey | XCIJLLJAHLKWBZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|