C16H12FN5 — CID 118262514
N-(5-fluoro-2-pyridinyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine (PubChem CID 118262514) has the molecular formula C16H12FN5 and a molecular weight of 293.31 g/mol. Its IUPAC name is N-(5-fluoro-2-pyridinyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine.
| Compound Name | N-(5-fluoro-2-pyridinyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
|---|---|
| PubChem CID | 118262514 |
| Molecular Formula | C16H12FN5 |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-(5-fluoro-2-pyridinyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
| SMILES | Cn1c2ccncc2c2ccc(Nc3ccc(F)cn3)nc21 |
| InChI | InChI=1S/C16H12FN5/c1-22-13-6-7-18-9-12(13)11-3-5-15(21-16(11)22)20-14-4-2-10(17)8-19-14/h2-9H,1H3,(H,19,20,21) |
| InChIKey | CFEDRKZWQPWKCJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |