C16H20N4O3S — CID 144891377
methanesulfonic acid;8-methyl-11-pyrrolidin-1-yl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 144891377) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is methanesulfonic acid;8-methyl-11-pyrrolidin-1-yl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | methanesulfonic acid;8-methyl-11-pyrrolidin-1-yl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 144891377 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | methanesulfonic acid;8-methyl-11-pyrrolidin-1-yl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CS(=O)(=O)O.Cn1c2ccncc2c2ccc(N3CCCC3)nc21 |
| InChI | InChI=1S/C15H16N4.CH4O3S/c1-18-13-6-7-16-10-12(13)11-4-5-14(17-15(11)18)19-8-2-3-9-19;1-5(2,3)4/h4-7,10H,2-3,8-9H2,1H3;1H3,(H,2,3,4) |
| InChIKey | MVXMCCSODXWUEE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|