C19H21FN4O — CID 118262592
11-[6-(2-fluoroethoxy)-2-azaspiro[3.3]heptan-2-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 118262592) has the molecular formula C19H21FN4O and a molecular weight of 340.40 g/mol. Its IUPAC name is 11-[6-(2-fluoroethoxy)-2-azaspiro[3.3]heptan-2-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-[6-(2-fluoroethoxy)-2-azaspiro[3.3]heptan-2-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 118262592 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 11-[6-(2-fluoroethoxy)-2-azaspiro[3.3]heptan-2-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cn1c2ccncc2c2ccc(N3CC4(CC(OCCF)C4)C3)nc21 |
| InChI | InChI=1S/C19H21FN4O/c1-23-16-4-6-21-10-15(16)14-2-3-17(22-18(14)23)24-11-19(12-24)8-13(9-19)25-7-5-20/h2-4,6,10,13H,5,7-9,11-12H2,1H3 |
| InChIKey | AFMLFTNLLSCCKN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |