C15H16N4O — CID 123761748
4-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)morpholine (PubChem CID 123761748) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)morpholine.
| Compound Name | 4-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)morpholine |
|---|---|
| PubChem CID | 123761748 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)morpholine |
| SMILES | Cn1c2ccncc2c2ccc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C15H16N4O/c1-18-13-4-5-16-10-12(13)11-2-3-14(17-15(11)18)19-6-8-20-9-7-19/h2-5,10H,6-9H2,1H3 |
| InChIKey | JTZDBBRGDJJYOA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |