C14H15N5O — CID 6414498
4-(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)morpholine (PubChem CID 6414498) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 4-(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)morpholine.
| Compound Name | 4-(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)morpholine |
|---|---|
| PubChem CID | 6414498 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4-(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)morpholine |
| SMILES | Cn1c2ccccc2c2nnc(N3CCOCC3)nc21 |
| InChI | InChI=1S/C14H15N5O/c1-18-11-5-3-2-4-10(11)12-13(18)15-14(17-16-12)19-6-8-20-9-7-19/h2-5H,6-9H2,1H3 |
| InChIKey | GHNRJHPIUUALHH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |