C12H10ClN5O — CID 66489936
2-chloro-N-(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)acetamide (PubChem CID 66489936) has the molecular formula C12H10ClN5O and a molecular weight of 275.70 g/mol. Its IUPAC name is 2-chloro-N-(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)acetamide.
| Compound Name | 2-chloro-N-(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)acetamide |
|---|---|
| PubChem CID | 66489936 |
| Molecular Formula | C12H10ClN5O |
| Molecular Weight | 275.70 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-chloro-N-(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)acetamide |
| SMILES | Cn1c2ccccc2c2nnc(NC(=O)CCl)nc21 |
| InChI | InChI=1S/C12H10ClN5O/c1-18-8-5-3-2-4-7(8)10-11(18)15-12(17-16-10)14-9(19)6-13/h2-5H,6H2,1H3,(H,14,15,17,19) |
| InChIKey | XIGHGKXHQLHBMG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.70 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|