C18H14N6O3S — CID 6415836
2-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(2-nitrophenyl)acetamide (PubChem CID 6415836) has the molecular formula C18H14N6O3S and a molecular weight of 394.42 g/mol. Its IUPAC name is 2-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 6415836 |
| Molecular Formula | C18H14N6O3S |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(2-nitrophenyl)acetamide |
| SMILES | Cn1c2ccccc2c2nnc(SCC(=O)Nc3ccccc3[N+](=O)[O-])nc21 |
| InChI | InChI=1S/C18H14N6O3S/c1-23-13-8-4-2-6-11(13)16-17(23)20-18(22-21-16)28-10-15(25)19-12-7-3-5-9-14(12)24(26)27/h2-9H,10H2,1H3,(H,19,25) |
| InChIKey | MOIVSCDWZVNCQA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|