C17H15N7O — CID 10806537
1-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)amino]-3-phenylurea (PubChem CID 10806537) has the molecular formula C17H15N7O and a molecular weight of 333.36 g/mol. Its IUPAC name is 1-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)amino]-3-phenylurea.
| Compound Name | 1-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)amino]-3-phenylurea |
|---|---|
| PubChem CID | 10806537 |
| Molecular Formula | C17H15N7O |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 1-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)amino]-3-phenylurea |
| SMILES | Cn1c2ccccc2c2nnc(NNC(=O)Nc3ccccc3)nc21 |
| InChI | InChI=1S/C17H15N7O/c1-24-13-10-6-5-9-12(13)14-15(24)19-16(21-20-14)22-23-17(25)18-11-7-3-2-4-8-11/h2-10H,1H3,(H2,18,23,25)(H,19,21,22) |
| InChIKey | FZIZRRJHNUWNHL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|