C16H14N6O — CID 7514744
5-methyl-N-[(Z)-(5-methylfuran-2-yl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 7514744) has the molecular formula C16H14N6O and a molecular weight of 306.33 g/mol. Its IUPAC name is 5-methyl-N-[(Z)-(5-methylfuran-2-yl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | 5-methyl-N-[(Z)-(5-methylfuran-2-yl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 7514744 |
| Molecular Formula | C16H14N6O |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 5-methyl-N-[(Z)-(5-methylfuran-2-yl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | Cc1ccc(/C=N\Nc2nnc3c4ccccc4n(C)c3n2)o1 |
| InChI | InChI=1S/C16H14N6O/c1-10-7-8-11(23-10)9-17-20-16-18-15-14(19-21-16)12-5-3-4-6-13(12)22(15)2/h3-9H,1-2H3,(H,18,20,21)/b17-9- |
| InChIKey | DOLIGNHMQPDILZ-MFOYZWKCSA-N |
| XLogP | 2.86 |
| TPSA | 81.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|