C23H26N6 — CID 53265403
5-hexyl-N-[(E)-(4-methylphenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265403) has the molecular formula C23H26N6 and a molecular weight of 386.50 g/mol. Its IUPAC name is 5-hexyl-N-[(E)-(4-methylphenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | 5-hexyl-N-[(E)-(4-methylphenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265403 |
| Molecular Formula | C23H26N6 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 5-hexyl-N-[(E)-(4-methylphenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CCCCCCn1c2ccccc2c2nnc(N/N=C/c3ccc(C)cc3)nc21 |
| InChI | InChI=1S/C23H26N6/c1-3-4-5-8-15-29-20-10-7-6-9-19(20)21-22(29)25-23(28-26-21)27-24-16-18-13-11-17(2)12-14-18/h6-7,9-14,16H,3-5,8,15H2,1-2H3,(H,25,27,28)/b24-16+ |
| InChIKey | VHDUDIQASWFXDU-LFVJCYFKSA-N |
| XLogP | 5.31 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|