C25H30N6 — CID 53265353
5-hexyl-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265353) has the molecular formula C25H30N6 and a molecular weight of 414.56 g/mol. Its IUPAC name is 5-hexyl-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | 5-hexyl-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265353 |
| Molecular Formula | C25H30N6 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 5-hexyl-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CCCCCCn1c2ccccc2c2nnc(N/N=C/c3ccc(C(C)C)cc3)nc21 |
| InChI | InChI=1S/C25H30N6/c1-4-5-6-9-16-31-22-11-8-7-10-21(22)23-24(31)27-25(30-28-23)29-26-17-19-12-14-20(15-13-19)18(2)3/h7-8,10-15,17-18H,4-6,9,16H2,1-3H3,(H,27,29,30)/b26-17+ |
| InChIKey | QMWOUTLZKVOMOM-YZSQISJMSA-N |
| XLogP | 6.13 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|