C25H23N7 — CID 6832373
5-benzyl-N-[[4-(dimethylamino)phenyl]methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 6832373) has the molecular formula C25H23N7 and a molecular weight of 421.51 g/mol. Its IUPAC name is 5-benzyl-N-[[4-(dimethylamino)phenyl]methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | 5-benzyl-N-[[4-(dimethylamino)phenyl]methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 6832373 |
| Molecular Formula | C25H23N7 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 5-benzyl-N-[[4-(dimethylamino)phenyl]methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CN(C)c1ccc(C=NNc2nnc3c4ccccc4n(Cc4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C25H23N7/c1-31(2)20-14-12-18(13-15-20)16-26-29-25-27-24-23(28-30-25)21-10-6-7-11-22(21)32(24)17-19-8-4-3-5-9-19/h3-16H,17H2,1-2H3,(H,27,29,30) |
| InChIKey | WLYUYNIOOWOXRS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 71.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|