C23H17ClN6O — CID 135494116
2-[[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-6-chlorophenol (PubChem CID 135494116) has the molecular formula C23H17ClN6O and a molecular weight of 428.88 g/mol. Its IUPAC name is 2-[[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-6-chlorophenol.
| Compound Name | 2-[[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-6-chlorophenol |
|---|---|
| PubChem CID | 135494116 |
| Molecular Formula | C23H17ClN6O |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 2-[[(5-benzyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-6-chlorophenol |
| SMILES | Oc1c(Cl)cccc1C=NNc1nnc2c3ccccc3n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C23H17ClN6O/c24-18-11-6-9-16(21(18)31)13-25-28-23-26-22-20(27-29-23)17-10-4-5-12-19(17)30(22)14-15-7-2-1-3-8-15/h1-13,31H,14H2,(H,26,28,29) |
| InChIKey | MEXSSPNEFHXYTE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|