C27H24BrClN6O — CID 53265462
N-[(E)-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-butyl-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265462) has the molecular formula C27H24BrClN6O and a molecular weight of 563.89 g/mol. Its IUPAC name is N-[(E)-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-butyl-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(E)-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-butyl-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265462 |
| Molecular Formula | C27H24BrClN6O |
| Molecular Weight | 563.89 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | N-[(E)-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-butyl-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CCCCn1c2ccccc2c2nnc(N/N=C/c3cc(Br)ccc3OCc3ccccc3Cl)nc21 |
| InChI | InChI=1S/C27H24BrClN6O/c1-2-3-14-35-23-11-7-5-9-21(23)25-26(35)31-27(34-32-25)33-30-16-19-15-20(28)12-13-24(19)36-17-18-8-4-6-10-22(18)29/h4-13,15-16H,2-3,14,17H2,1H3,(H,31,33,34)/b30-16+ |
| InChIKey | QQDGMCVDDOJWRQ-OKCVXOCRSA-N |
| XLogP | 7.22 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.89 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|