C23H25BrN6O2 — CID 53268905
N-[(E)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53268905) has the molecular formula C23H25BrN6O2 and a molecular weight of 497.40 g/mol. Its IUPAC name is N-[(E)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(E)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53268905 |
| Molecular Formula | C23H25BrN6O2 |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | N-[(E)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CCCn1c2ccccc2c2nnc(N/N=C/c3cc(Br)c(OCC)c(OCC)c3)nc21 |
| InChI | InChI=1S/C23H25BrN6O2/c1-4-11-30-18-10-8-7-9-16(18)20-22(30)26-23(29-27-20)28-25-14-15-12-17(24)21(32-6-3)19(13-15)31-5-2/h7-10,12-14H,4-6,11H2,1-3H3,(H,26,28,29)/b25-14+ |
| InChIKey | NISIAMGYXOGYFZ-AFUMVMLFSA-N |
| XLogP | 5.40 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|