C28H26BrClN6O2 — CID 53265510
N-[(E)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-butyl-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265510) has the molecular formula C28H26BrClN6O2 and a molecular weight of 593.91 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-butyl-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(E)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-butyl-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265510 |
| Molecular Formula | C28H26BrClN6O2 |
| Molecular Weight | 593.91 g/mol |
| Exact Mass | 592.10 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-5-butyl-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CCCCn1c2ccccc2c2nnc(N/N=C/c3cc(Br)c(OCc4ccccc4Cl)c(OC)c3)nc21 |
| InChI | InChI=1S/C28H26BrClN6O2/c1-3-4-13-36-23-12-8-6-10-20(23)25-27(36)32-28(35-33-25)34-31-16-18-14-21(29)26(24(15-18)37-2)38-17-19-9-5-7-11-22(19)30/h5-12,14-16H,3-4,13,17H2,1-2H3,(H,32,34,35)/b31-16+ |
| InChIKey | TXTUTZRCDHHAPO-WCMJOSRZSA-N |
| XLogP | 7.23 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.91 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|