C31H34N6O2 — CID 53265490
N-[(E)-[4-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265490) has the molecular formula C31H34N6O2 and a molecular weight of 522.65 g/mol. Its IUPAC name is N-[(E)-[4-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(E)-[4-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265490 |
| Molecular Formula | C31H34N6O2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | N-[(E)-[4-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CCCn1c2ccccc2c2nnc(N/N=C/c3ccc(OCc4ccc(C(C)(C)C)cc4)c(OC)c3)nc21 |
| InChI | InChI=1S/C31H34N6O2/c1-6-17-37-25-10-8-7-9-24(25)28-29(37)33-30(36-34-28)35-32-19-22-13-16-26(27(18-22)38-5)39-20-21-11-14-23(15-12-21)31(2,3)4/h7-16,18-19H,6,17,20H2,1-5H3,(H,33,35,36)/b32-19+ |
| InChIKey | FTWKXGHUXCXUSW-BIZUNTBRSA-N |
| XLogP | 6.72 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|