C19H17ClN6 — CID 53265186
N-[(E)-(3-chlorophenyl)methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265186) has the molecular formula C19H17ClN6 and a molecular weight of 364.84 g/mol. Its IUPAC name is N-[(E)-(3-chlorophenyl)methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(E)-(3-chlorophenyl)methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265186 |
| Molecular Formula | C19H17ClN6 |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[(E)-(3-chlorophenyl)methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CCCn1c2ccccc2c2nnc(N/N=C/c3cccc(Cl)c3)nc21 |
| InChI | InChI=1S/C19H17ClN6/c1-2-10-26-16-9-4-3-8-15(16)17-18(26)22-19(25-23-17)24-21-12-13-6-5-7-14(20)11-13/h3-9,11-12H,2,10H2,1H3,(H,22,24,25)/b21-12+ |
| InChIKey | WGZOYONDWWXGRE-CIAFOILYSA-N |
| XLogP | 4.49 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|