C23H17IN6 — CID 6808398
5-benzyl-N-[(3-iodophenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 6808398) has the molecular formula C23H17IN6 and a molecular weight of 504.34 g/mol. Its IUPAC name is 5-benzyl-N-[(3-iodophenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | 5-benzyl-N-[(3-iodophenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 6808398 |
| Molecular Formula | C23H17IN6 |
| Molecular Weight | 504.34 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | 5-benzyl-N-[(3-iodophenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | Ic1cccc(C=NNc2nnc3c4ccccc4n(Cc4ccccc4)c3n2)c1 |
| InChI | InChI=1S/C23H17IN6/c24-18-10-6-9-17(13-18)14-25-28-23-26-22-21(27-29-23)19-11-4-5-12-20(19)30(22)15-16-7-2-1-3-8-16/h1-14H,15H2,(H,26,28,29) |
| InChIKey | LGOYCLAYZZUUFG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.34 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|