C25H22N6O — CID 53265660
5-ethyl-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265660) has the molecular formula C25H22N6O and a molecular weight of 422.49 g/mol. Its IUPAC name is 5-ethyl-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | 5-ethyl-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265660 |
| Molecular Formula | C25H22N6O |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 5-ethyl-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CCn1c2ccccc2c2nnc(N/N=C/c3ccccc3OCc3ccccc3)nc21 |
| InChI | InChI=1S/C25H22N6O/c1-2-31-21-14-8-7-13-20(21)23-24(31)27-25(30-28-23)29-26-16-19-12-6-9-15-22(19)32-17-18-10-4-3-5-11-18/h3-16H,2,17H2,1H3,(H,27,29,30)/b26-16+ |
| InChIKey | XFHRUCMFPIFZFP-WGOQTCKBSA-N |
| XLogP | 5.02 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|