C18H15BrN6O — CID 135726324
2-[(E)-[(8-bromo-5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol (PubChem CID 135726324) has the molecular formula C18H15BrN6O and a molecular weight of 411.26 g/mol. Its IUPAC name is 2-[(E)-[(8-bromo-5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-[(E)-[(8-bromo-5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135726324 |
| Molecular Formula | C18H15BrN6O |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2-[(E)-[(8-bromo-5-ethyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol |
| SMILES | CCn1c2ccc(Br)cc2c2nnc(N/N=C/c3ccccc3O)nc21 |
| InChI | InChI=1S/C18H15BrN6O/c1-2-25-14-8-7-12(19)9-13(14)16-17(25)21-18(24-22-16)23-20-10-11-5-3-4-6-15(11)26/h3-10,26H,2H2,1H3,(H,21,23,24)/b20-10+ |
| InChIKey | FJJNLCKMGOLGNS-KEBDBYFISA-N |
| XLogP | 3.91 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|