C17H13BrN6O — CID 135580336
4-[(E)-[(8-bromo-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol (PubChem CID 135580336) has the molecular formula C17H13BrN6O and a molecular weight of 397.24 g/mol. Its IUPAC name is 4-[(E)-[(8-bromo-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-[(E)-[(8-bromo-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135580336 |
| Molecular Formula | C17H13BrN6O |
| Molecular Weight | 397.24 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 4-[(E)-[(8-bromo-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cn1c2ccc(Br)cc2c2nnc(N/N=C/c3ccc(O)cc3)nc21 |
| InChI | InChI=1S/C17H13BrN6O/c1-24-14-7-4-11(18)8-13(14)15-16(24)20-17(23-21-15)22-19-9-10-2-5-12(25)6-3-10/h2-9,25H,1H3,(H,20,22,23)/b19-9+ |
| InChIKey | UAXSLOYVUIRGLD-DJKKODMXSA-N |
| XLogP | 3.43 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|