C19H17BrN6O2 — CID 53265311
8-bromo-N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265311) has the molecular formula C19H17BrN6O2 and a molecular weight of 441.29 g/mol. Its IUPAC name is 8-bromo-N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | 8-bromo-N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265311 |
| Molecular Formula | C19H17BrN6O2 |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 8-bromo-N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | COc1ccc(OC)c(/C=N/Nc2nnc3c4cc(Br)ccc4n(C)c3n2)c1 |
| InChI | InChI=1S/C19H17BrN6O2/c1-26-15-6-4-12(20)9-14(15)17-18(26)22-19(25-23-17)24-21-10-11-8-13(27-2)5-7-16(11)28-3/h4-10H,1-3H3,(H,22,24,25)/b21-10+ |
| InChIKey | NMDBMKWKBRSLGR-UFFVCSGVSA-N |
| XLogP | 3.74 |
| TPSA | 86.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|