C17H12BrN7O2 — CID 53265137
8-bromo-5-methyl-N-[(E)-(2-nitrophenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265137) has the molecular formula C17H12BrN7O2 and a molecular weight of 426.23 g/mol. Its IUPAC name is 8-bromo-5-methyl-N-[(E)-(2-nitrophenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | 8-bromo-5-methyl-N-[(E)-(2-nitrophenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265137 |
| Molecular Formula | C17H12BrN7O2 |
| Molecular Weight | 426.23 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 8-bromo-5-methyl-N-[(E)-(2-nitrophenyl)methylideneamino]-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | Cn1c2ccc(Br)cc2c2nnc(N/N=C/c3ccccc3[N+](=O)[O-])nc21 |
| InChI | InChI=1S/C17H12BrN7O2/c1-24-14-7-6-11(18)8-12(14)15-16(24)20-17(23-21-15)22-19-9-10-4-2-3-5-13(10)25(26)27/h2-9H,1H3,(H,20,22,23)/b19-9+ |
| InChIKey | LWWZZMVGGXOQLY-DJKKODMXSA-N |
| XLogP | 3.63 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|