C18H15N7O3 — CID 53265105
N-[(E)-(4-methoxy-3-nitrophenyl)methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265105) has the molecular formula C18H15N7O3 and a molecular weight of 377.36 g/mol. Its IUPAC name is N-[(E)-(4-methoxy-3-nitrophenyl)methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(E)-(4-methoxy-3-nitrophenyl)methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265105 |
| Molecular Formula | C18H15N7O3 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-[(E)-(4-methoxy-3-nitrophenyl)methylideneamino]-5-methyl-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | COc1ccc(/C=N/Nc2nnc3c4ccccc4n(C)c3n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15N7O3/c1-24-13-6-4-3-5-12(13)16-17(24)20-18(23-21-16)22-19-10-11-7-8-15(28-2)14(9-11)25(26)27/h3-10H,1-2H3,(H,20,22,23)/b19-10+ |
| InChIKey | JJEZWGDKARFRHV-VXLYETTFSA-N |
| XLogP | 2.88 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|