C17H12ClN7O3 — CID 135489020
4-chloro-2-[(E)-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-6-nitrophenol (PubChem CID 135489020) has the molecular formula C17H12ClN7O3 and a molecular weight of 397.78 g/mol. Its IUPAC name is 4-chloro-2-[(E)-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-6-nitrophenol.
| Compound Name | 4-chloro-2-[(E)-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-6-nitrophenol |
|---|---|
| PubChem CID | 135489020 |
| Molecular Formula | C17H12ClN7O3 |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 4-chloro-2-[(E)-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)hydrazinylidene]methyl]-6-nitrophenol |
| SMILES | Cn1c2ccccc2c2nnc(N/N=C/c3cc(Cl)cc([N+](=O)[O-])c3O)nc21 |
| InChI | InChI=1S/C17H12ClN7O3/c1-24-12-5-3-2-4-11(12)14-16(24)20-17(23-21-14)22-19-8-9-6-10(18)7-13(15(9)26)25(27)28/h2-8,26H,1H3,(H,20,22,23)/b19-8+ |
| InChIKey | BNSVGSMZNIMFIR-UFWORHAWSA-N |
| XLogP | 3.23 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|