C26H24N6O — CID 53265763
N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265763) has the molecular formula C26H24N6O and a molecular weight of 436.52 g/mol. Its IUPAC name is N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265763 |
| Molecular Formula | C26H24N6O |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-[(E)-(3-phenylmethoxyphenyl)methylideneamino]-5-propyl-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CCCn1c2ccccc2c2nnc(N/N=C/c3cccc(OCc4ccccc4)c3)nc21 |
| InChI | InChI=1S/C26H24N6O/c1-2-15-32-23-14-7-6-13-22(23)24-25(32)28-26(31-29-24)30-27-17-20-11-8-12-21(16-20)33-18-19-9-4-3-5-10-19/h3-14,16-17H,2,15,18H2,1H3,(H,28,30,31)/b27-17+ |
| InChIKey | VOFQGBWKKZQQAN-WPWMEQJKSA-N |
| XLogP | 5.41 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|