C22H23FN6 — CID 53265202
N-[(E)-(4-fluorophenyl)methylideneamino]-5-hexyl-[1,2,4]triazino[5,6-b]indol-3-amine (PubChem CID 53265202) has the molecular formula C22H23FN6 and a molecular weight of 390.47 g/mol. Its IUPAC name is N-[(E)-(4-fluorophenyl)methylideneamino]-5-hexyl-[1,2,4]triazino[5,6-b]indol-3-amine.
| Compound Name | N-[(E)-(4-fluorophenyl)methylideneamino]-5-hexyl-[1,2,4]triazino[5,6-b]indol-3-amine |
|---|---|
| PubChem CID | 53265202 |
| Molecular Formula | C22H23FN6 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | N-[(E)-(4-fluorophenyl)methylideneamino]-5-hexyl-[1,2,4]triazino[5,6-b]indol-3-amine |
| SMILES | CCCCCCn1c2ccccc2c2nnc(N/N=C/c3ccc(F)cc3)nc21 |
| InChI | InChI=1S/C22H23FN6/c1-2-3-4-7-14-29-19-9-6-5-8-18(19)20-21(29)25-22(28-26-20)27-24-15-16-10-12-17(23)13-11-16/h5-6,8-13,15H,2-4,7,14H2,1H3,(H,25,27,28)/b24-15+ |
| InChIKey | OZMRGVQGLHPOBN-BUVRLJJBSA-N |
| XLogP | 5.14 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|