C17H17FN6 — CID 118262780
N-[1-(3-fluoropropyl)pyrazol-4-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine (PubChem CID 118262780) has the molecular formula C17H17FN6 and a molecular weight of 324.36 g/mol. Its IUPAC name is N-[1-(3-fluoropropyl)pyrazol-4-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine.
| Compound Name | N-[1-(3-fluoropropyl)pyrazol-4-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
|---|---|
| PubChem CID | 118262780 |
| Molecular Formula | C17H17FN6 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[1-(3-fluoropropyl)pyrazol-4-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
| SMILES | Cn1c2ccncc2c2ccc(Nc3cnn(CCCF)c3)nc21 |
| InChI | InChI=1S/C17H17FN6/c1-23-15-5-7-19-10-14(15)13-3-4-16(22-17(13)23)21-12-9-20-24(11-12)8-2-6-18/h3-5,7,9-11H,2,6,8H2,1H3,(H,21,22) |
| InChIKey | YXAMBGQFTPSKAA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |