C19H16F2N4O — CID 118262451
N-[4-fluoro-3-(2-fluoroethoxy)phenyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine (PubChem CID 118262451) has the molecular formula C19H16F2N4O and a molecular weight of 354.36 g/mol. Its IUPAC name is N-[4-fluoro-3-(2-fluoroethoxy)phenyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine.
| Compound Name | N-[4-fluoro-3-(2-fluoroethoxy)phenyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
|---|---|
| PubChem CID | 118262451 |
| Molecular Formula | C19H16F2N4O |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-[4-fluoro-3-(2-fluoroethoxy)phenyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
| SMILES | Cn1c2ccncc2c2ccc(Nc3ccc(F)c(OCCF)c3)nc21 |
| InChI | InChI=1S/C19H16F2N4O/c1-25-16-6-8-22-11-14(16)13-3-5-18(24-19(13)25)23-12-2-4-15(21)17(10-12)26-9-7-20/h2-6,8,10-11H,7,9H2,1H3,(H,23,24) |
| InChIKey | NLUDSWRPDAQFFM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |