About CID 102142656
CID 102142656 (PubChem CID 102142656) has the molecular formula C10H6N3O
and a molecular weight of 184.18 g/mol.
Molecular Properties
| Compound Name | CID 102142656 |
| PubChem CID | 102142656 |
| Molecular Formula | C10H6N3O |
| Molecular Weight | 184.18 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | — |
| SMILES | [O]n1c2ccncc2c2cnccc21 |
| InChI | InChI=1S/C10H6N3O/c14-13-9-1-3-11-5-7(9)8-6-12-4-2-10(8)13/h1-6H |
| InChIKey | WXRFZVPNZOMMEP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 50.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze CID 102142656 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102142656?
The IUPAC name of CID 102142656 (CID 102142656) is not available.
What is the SMILES notation for CID 102142656?
The canonical SMILES for CID 102142656 is [O]n1c2ccncc2c2cnccc21.
What is the InChIKey of CID 102142656?
The InChIKey is WXRFZVPNZOMMEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N3O/c14-13-9-1-3-11-5-7(9)8-6-12-4-2-10(8)13/h1-6H.
What are the key properties of CID 102142656?
CID 102142656 has a molecular weight of 184.18 g/mol, XLogP of 1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102142656 is sourced from PubChem (CID 102142656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).