C8H8N2O — CID 137437348
1-methylpyrrolo[3,2-c]pyridin-3-ol (PubChem CID 137437348) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is 1-methylpyrrolo[3,2-c]pyridin-3-ol.
| Compound Name | 1-methylpyrrolo[3,2-c]pyridin-3-ol |
|---|---|
| PubChem CID | 137437348 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 1-methylpyrrolo[3,2-c]pyridin-3-ol |
| SMILES | Cn1cc(O)c2cnccc21 |
| InChI | InChI=1S/C8H8N2O/c1-10-5-8(11)6-4-9-3-2-7(6)10/h2-5,11H,1H3 |
| InChIKey | OOTLQRXZAAGNRK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |