C10H15N3 — CID 142426544
ethane;1-methylpyrrolo[2,3-c]pyridin-3-amine (PubChem CID 142426544) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is ethane;1-methylpyrrolo[2,3-c]pyridin-3-amine.
| Compound Name | ethane;1-methylpyrrolo[2,3-c]pyridin-3-amine |
|---|---|
| PubChem CID | 142426544 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | ethane;1-methylpyrrolo[2,3-c]pyridin-3-amine |
| SMILES | CC.Cn1cc(N)c2ccncc21 |
| InChI | InChI=1S/C8H9N3.C2H6/c1-11-5-7(9)6-2-3-10-4-8(6)11;1-2/h2-5H,9H2,1H3;1-2H3 |
| InChIKey | JUXSYZCMCMXKGL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |