C17H13N3 — CID 166360060
6-(1-methylpyrrolo[2,3-c]pyridin-3-yl)isoquinoline (PubChem CID 166360060) has the molecular formula C17H13N3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 6-(1-methylpyrrolo[2,3-c]pyridin-3-yl)isoquinoline.
| Compound Name | 6-(1-methylpyrrolo[2,3-c]pyridin-3-yl)isoquinoline |
|---|---|
| PubChem CID | 166360060 |
| Molecular Formula | C17H13N3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 6-(1-methylpyrrolo[2,3-c]pyridin-3-yl)isoquinoline |
| SMILES | Cn1cc(-c2ccc3cnccc3c2)c2ccncc21 |
| InChI | InChI=1S/C17H13N3/c1-20-11-16(15-5-7-19-10-17(15)20)13-2-3-14-9-18-6-4-12(14)8-13/h2-11H,1H3 |
| InChIKey | IRXPYUYLLIHGDB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |