C7H7N3S — CID 142555682
1-methyl-2H-pyrazolo[4,3-c]pyridine-3-thione (PubChem CID 142555682) has the molecular formula C7H7N3S and a molecular weight of 165.22 g/mol. Its IUPAC name is 1-methyl-2H-pyrazolo[4,3-c]pyridine-3-thione.
| Compound Name | 1-methyl-2H-pyrazolo[4,3-c]pyridine-3-thione |
|---|---|
| PubChem CID | 142555682 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 1-methyl-2H-pyrazolo[4,3-c]pyridine-3-thione |
| SMILES | Cn1[nH]c(=S)c2cnccc21 |
| InChI | InChI=1S/C7H7N3S/c1-10-6-2-3-8-4-5(6)7(11)9-10/h2-4H,1H3,(H,9,11) |
| InChIKey | AHSHBBDOMBEZDH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|