C12H12N4 — CID 116986023
(5-methylpyrido[4,3-b]indol-8-yl)hydrazine (PubChem CID 116986023) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is (5-methylpyrido[4,3-b]indol-8-yl)hydrazine.
| Compound Name | (5-methylpyrido[4,3-b]indol-8-yl)hydrazine |
|---|---|
| PubChem CID | 116986023 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | (5-methylpyrido[4,3-b]indol-8-yl)hydrazine |
| SMILES | Cn1c2ccncc2c2cc(NN)ccc21 |
| InChI | InChI=1S/C12H12N4/c1-16-11-3-2-8(15-13)6-9(11)10-7-14-5-4-12(10)16/h2-7,15H,13H2,1H3 |
| InChIKey | SULWTLREJTYCAA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|