C16H17N3 — CID 116985955
3-(5-methylpyrido[4,3-b]indol-8-yl)cyclobutan-1-amine (PubChem CID 116985955) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-(5-methylpyrido[4,3-b]indol-8-yl)cyclobutan-1-amine.
| Compound Name | 3-(5-methylpyrido[4,3-b]indol-8-yl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 116985955 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 3-(5-methylpyrido[4,3-b]indol-8-yl)cyclobutan-1-amine |
| SMILES | Cn1c2ccncc2c2cc(C3CC(N)C3)ccc21 |
| InChI | InChI=1S/C16H17N3/c1-19-15-3-2-10(11-6-12(17)7-11)8-13(15)14-9-18-5-4-16(14)19/h2-5,8-9,11-12H,6-7,17H2,1H3 |
| InChIKey | PATUGTOMARZIFS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |