C10H14N2O — CID 118049997
3-(2-methoxy-4-pyridinyl)cyclobutan-1-amine (PubChem CID 118049997) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 3-(2-methoxy-4-pyridinyl)cyclobutan-1-amine.
| Compound Name | 3-(2-methoxy-4-pyridinyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 118049997 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 3-(2-methoxy-4-pyridinyl)cyclobutan-1-amine |
| SMILES | COc1cc(C2CC(N)C2)ccn1 |
| InChI | InChI=1S/C10H14N2O/c1-13-10-6-7(2-3-12-10)8-4-9(11)5-8/h2-3,6,8-9H,4-5,11H2,1H3 |
| InChIKey | VPSRSBKSYXNSFM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |