C15H18N2O2 — CID 116995190
3-(6,7-dimethoxyisoquinolin-1-yl)cyclobutan-1-amine (PubChem CID 116995190) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-(6,7-dimethoxyisoquinolin-1-yl)cyclobutan-1-amine.
| Compound Name | 3-(6,7-dimethoxyisoquinolin-1-yl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 116995190 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-(6,7-dimethoxyisoquinolin-1-yl)cyclobutan-1-amine |
| SMILES | COc1cc2ccnc(C3CC(N)C3)c2cc1OC |
| InChI | InChI=1S/C15H18N2O2/c1-18-13-7-9-3-4-17-15(10-5-11(16)6-10)12(9)8-14(13)19-2/h3-4,7-8,10-11H,5-6,16H2,1-2H3 |
| InChIKey | ZDYYQDBMAYDYSF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |