C12H18N2O2 — CID 177322364
2-(2-methoxy-4-pyridinyl)-4-methyl-1,4-oxazepane (PubChem CID 177322364) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-(2-methoxy-4-pyridinyl)-4-methyl-1,4-oxazepane.
| Compound Name | 2-(2-methoxy-4-pyridinyl)-4-methyl-1,4-oxazepane |
|---|---|
| PubChem CID | 177322364 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2-(2-methoxy-4-pyridinyl)-4-methyl-1,4-oxazepane |
| SMILES | COc1cc(C2CN(C)CCCO2)ccn1 |
| InChI | InChI=1S/C12H18N2O2/c1-14-6-3-7-16-11(9-14)10-4-5-13-12(8-10)15-2/h4-5,8,11H,3,6-7,9H2,1-2H3 |
| InChIKey | FRXXCJGLAKXHPX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |