C16H17N3 — CID 116986165
N-[(5-methylpyrido[4,3-b]indol-7-yl)methyl]cyclopropanamine (PubChem CID 116986165) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is N-[(5-methylpyrido[4,3-b]indol-7-yl)methyl]cyclopropanamine.
| Compound Name | N-[(5-methylpyrido[4,3-b]indol-7-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 116986165 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-[(5-methylpyrido[4,3-b]indol-7-yl)methyl]cyclopropanamine |
| SMILES | Cn1c2ccncc2c2ccc(CNC3CC3)cc21 |
| InChI | InChI=1S/C16H17N3/c1-19-15-6-7-17-10-14(15)13-5-2-11(8-16(13)19)9-18-12-3-4-12/h2,5-8,10,12,18H,3-4,9H2,1H3 |
| InChIKey | YBHNZWUAOPKBHL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |