C13H12N2O — CID 116986177
(5-methylpyrido[4,3-b]indol-7-yl)methanol (PubChem CID 116986177) has the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. Its IUPAC name is (5-methylpyrido[4,3-b]indol-7-yl)methanol.
| Compound Name | (5-methylpyrido[4,3-b]indol-7-yl)methanol |
|---|---|
| PubChem CID | 116986177 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | (5-methylpyrido[4,3-b]indol-7-yl)methanol |
| SMILES | Cn1c2ccncc2c2ccc(CO)cc21 |
| InChI | InChI=1S/C13H12N2O/c1-15-12-4-5-14-7-11(12)10-3-2-9(8-16)6-13(10)15/h2-7,16H,8H2,1H3 |
| InChIKey | BLXBPIJDOBKJEZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |