C12H21N3 — CID 142426543
ethane;1-methylpyrrolo[3,2-c]pyridin-2-amine (PubChem CID 142426543) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is ethane;1-methylpyrrolo[3,2-c]pyridin-2-amine.
| Compound Name | ethane;1-methylpyrrolo[3,2-c]pyridin-2-amine |
|---|---|
| PubChem CID | 142426543 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | ethane;1-methylpyrrolo[3,2-c]pyridin-2-amine |
| SMILES | CC.CC.Cn1c(N)cc2cnccc21 |
| InChI | InChI=1S/C8H9N3.2C2H6/c1-11-7-2-3-10-5-6(7)4-8(11)9;2*1-2/h2-5H,9H2,1H3;2*1-2H3 |
| InChIKey | VKGSPBICRXZBFV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |