About azane;1,3-dimethylpyrazolo[4,5-c]pyridine
azane;1,3-dimethylpyrazolo[4,5-c]pyridine (PubChem CID 175481142) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is azane;1,3-dimethylpyrazolo[4,5-c]pyridine.
Molecular Properties
| Compound Name | azane;1,3-dimethylpyrazolo[4,5-c]pyridine |
| PubChem CID | 175481142 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | azane;1,3-dimethylpyrazolo[4,5-c]pyridine |
| SMILES | Cc1nn(C)c2ccncc12.N |
| InChI | InChI=1S/C8H9N3.H3N/c1-6-7-5-9-4-3-8(7)11(2)10-6;/h3-5H,1-2H3;1H3 |
| InChIKey | GBWFNYRMJGCERU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;1,3-dimethylpyrazolo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,3-dimethylpyrazolo[4,5-c]pyridine?
The IUPAC name of azane;1,3-dimethylpyrazolo[4,5-c]pyridine (CID 175481142) is azane;1,3-dimethylpyrazolo[4,5-c]pyridine.
What is the SMILES notation for azane;1,3-dimethylpyrazolo[4,5-c]pyridine?
The canonical SMILES for azane;1,3-dimethylpyrazolo[4,5-c]pyridine is Cc1nn(C)c2ccncc12.N.
What is the InChIKey of azane;1,3-dimethylpyrazolo[4,5-c]pyridine?
The InChIKey is GBWFNYRMJGCERU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3.H3N/c1-6-7-5-9-4-3-8(7)11(2)10-6;/h3-5H,1-2H3;1H3.
What are the key properties of azane;1,3-dimethylpyrazolo[4,5-c]pyridine?
azane;1,3-dimethylpyrazolo[4,5-c]pyridine has a molecular weight of 164.21 g/mol, XLogP of 1.44, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,3-dimethylpyrazolo[4,5-c]pyridine is sourced from PubChem (CID 175481142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).