C12H18N2S — CID 123597078
(1,3-dimethylindazol-5-yl)-trimethyl-λ4-sulfane (PubChem CID 123597078) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is (1,3-dimethylindazol-5-yl)-trimethyl-λ4-sulfane.
| Compound Name | (1,3-dimethylindazol-5-yl)-trimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 123597078 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | (1,3-dimethylindazol-5-yl)-trimethyl-λ4-sulfane |
| SMILES | Cc1nn(C)c2ccc(S(C)(C)C)cc12 |
| InChI | InChI=1S/C12H18N2S/c1-9-11-8-10(15(3,4)5)6-7-12(11)14(2)13-9/h6-8H,1-5H3 |
| InChIKey | MCENVPNECBPSAG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |