C10H11N3O2 — CID 84722038
5-amino-1,3-dimethylindazole-6-carboxylic acid (PubChem CID 84722038) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 5-amino-1,3-dimethylindazole-6-carboxylic acid.
| Compound Name | 5-amino-1,3-dimethylindazole-6-carboxylic acid |
|---|---|
| PubChem CID | 84722038 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 5-amino-1,3-dimethylindazole-6-carboxylic acid |
| SMILES | Cc1nn(C)c2cc(C(=O)O)c(N)cc12 |
| InChI | InChI=1S/C10H11N3O2/c1-5-6-3-8(11)7(10(14)15)4-9(6)13(2)12-5/h3-4H,11H2,1-2H3,(H,14,15) |
| InChIKey | GSBOUJXTTXEOMC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|