1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid

C10H11N3O2 — CID 125424717

IUPAC1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid
SMILESCc1cc2c(C)nn(C)c2nc1C(=O)O
InChIInChI=1S/C10H11N3O2/c1-5-4-7-6(2)12-13(3)9(7)11-8(5)10(14)15/h4H,1-3H3,(H,14,15)
InChIKeyMNGBCAWPKWWQNC-UHFFFAOYSA-N
MW205.22 g/mol
LogP1.28
Rot. Bonds1

About 1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid

1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid (PubChem CID 125424717) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid.

Molecular Properties

Compound Name1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid
PubChem CID125424717
Molecular FormulaC10H11N3O2
Molecular Weight205.22 g/mol
Exact Mass205.09
IUPAC Name1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid
SMILESCc1cc2c(C)nn(C)c2nc1C(=O)O
InChIInChI=1S/C10H11N3O2/c1-5-4-7-6(2)12-13(3)9(7)11-8(5)10(14)15/h4H,1-3H3,(H,14,15)
InChIKeyMNGBCAWPKWWQNC-UHFFFAOYSA-N
XLogP1.28
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.22
LogP ≤ 51.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid?
The IUPAC name of 1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid (CID 125424717) is 1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid.
What is the SMILES notation for 1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid?
The canonical SMILES for 1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid is Cc1cc2c(C)nn(C)c2nc1C(=O)O.
What is the InChIKey of 1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid?
The InChIKey is MNGBCAWPKWWQNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2/c1-5-4-7-6(2)12-13(3)9(7)11-8(5)10(14)15/h4H,1-3H3,(H,14,15).
What are the key properties of 1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid?
1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid has a molecular weight of 205.22 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trimethylpyrazolo[5,4-b]pyridine-6-carboxylic acid is sourced from PubChem (CID 125424717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).