C10H9ClN2O — CID 117109823
6-chloro-1,3-dimethylindazole-5-carbaldehyde (PubChem CID 117109823) has the molecular formula C10H9ClN2O and a molecular weight of 208.65 g/mol. Its IUPAC name is 6-chloro-1,3-dimethylindazole-5-carbaldehyde.
| Compound Name | 6-chloro-1,3-dimethylindazole-5-carbaldehyde |
|---|---|
| PubChem CID | 117109823 |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 6-chloro-1,3-dimethylindazole-5-carbaldehyde |
| SMILES | Cc1nn(C)c2cc(Cl)c(C=O)cc12 |
| InChI | InChI=1S/C10H9ClN2O/c1-6-8-3-7(5-14)9(11)4-10(8)13(2)12-6/h3-5H,1-2H3 |
| InChIKey | VAEOHZGDIKIVTQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|